C33H27F3N2O2 — CID 66914153
3-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]propanoic acid (PubChem CID 66914153) has the molecular formula C33H27F3N2O2 and a molecular weight of 540.59 g/mol. Its IUPAC name is 3-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66914153 |
| Molecular Formula | C33H27F3N2O2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(CNc2cccc(-c3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C33H27F3N2O2/c34-33(35,36)29-11-5-10-28-31(26(21-38-32(28)29)18-23-6-2-1-3-7-23)25-8-4-9-27(19-25)37-20-24-14-12-22(13-15-24)16-17-30(39)40/h1-15,19,21,37H,16-18,20H2,(H,39,40) |
| InChIKey | DWHPAAPXSBJPLC-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |