C32H26F3N3O4 — CID 66914151
3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline (PubChem CID 66914151) has the molecular formula C32H26F3N3O4 and a molecular weight of 573.57 g/mol. Its IUPAC name is 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline.
| Compound Name | 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline |
|---|---|
| PubChem CID | 66914151 |
| Molecular Formula | C32H26F3N3O4 |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]aniline |
| SMILES | COc1cc(CNc2cccc(-c3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C32H26F3N3O4/c1-41-28-16-22(27(38(39)40)17-29(28)42-2)18-36-24-11-6-10-21(15-24)30-23(14-20-8-4-3-5-9-20)19-37-31-25(30)12-7-13-26(31)32(33,34)35/h3-13,15-17,19,36H,14,18H2,1-2H3 |
| InChIKey | PZACSFJGPRHOMU-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|