C30H22BrF3N2O — CID 66913716
2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]-4-bromophenol (PubChem CID 66913716) has the molecular formula C30H22BrF3N2O and a molecular weight of 563.42 g/mol. Its IUPAC name is 2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]-4-bromophenol.
| Compound Name | 2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]-4-bromophenol |
|---|---|
| PubChem CID | 66913716 |
| Molecular Formula | C30H22BrF3N2O |
| Molecular Weight | 563.42 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1CNc1cccc(-c2c(Cc3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C30H22BrF3N2O/c31-23-12-13-27(37)21(15-23)17-35-24-9-4-8-20(16-24)28-22(14-19-6-2-1-3-7-19)18-36-29-25(28)10-5-11-26(29)30(32,33)34/h1-13,15-16,18,35,37H,14,17H2 |
| InChIKey | KSQUKTCIWJLOGQ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.42 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|