C31H25F3N2 — CID 141120011
N-benzyl-3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-methylaniline (PubChem CID 141120011) has the molecular formula C31H25F3N2 and a molecular weight of 482.55 g/mol. Its IUPAC name is N-benzyl-3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-methylaniline.
| Compound Name | N-benzyl-3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-methylaniline |
|---|---|
| PubChem CID | 141120011 |
| Molecular Formula | C31H25F3N2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-benzyl-3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-methylaniline |
| SMILES | CN(Cc1ccccc1)c1cccc(-c2c(Cc3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C31H25F3N2/c1-36(21-23-12-6-3-7-13-23)26-15-8-14-24(19-26)29-25(18-22-10-4-2-5-11-22)20-35-30-27(29)16-9-17-28(30)31(32,33)34/h2-17,19-20H,18,21H2,1H3 |
| InChIKey | BVROQLOKAZMBTQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |