C30H23F3N2O2S — CID 91507645
[2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]thiophen-3-yl] acetate (PubChem CID 91507645) has the molecular formula C30H23F3N2O2S and a molecular weight of 532.59 g/mol. Its IUPAC name is [2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]thiophen-3-yl] acetate.
| Compound Name | [2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]thiophen-3-yl] acetate |
|---|---|
| PubChem CID | 91507645 |
| Molecular Formula | C30H23F3N2O2S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | [2-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]thiophen-3-yl] acetate |
| SMILES | CC(=O)Oc1ccsc1CNc1cccc(-c2c(Cc3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C30H23F3N2O2S/c1-19(36)37-26-13-14-38-27(26)18-34-23-10-5-9-21(16-23)28-22(15-20-7-3-2-4-8-20)17-35-29-24(28)11-6-12-25(29)30(31,32)33/h2-14,16-17,34H,15,18H2,1H3 |
| InChIKey | OMKDYWQQLILUAB-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |