C30H20F3N3O3 — CID 87202457
2-[4-[3-[(3-nitrophenyl)methylamino]phenyl]-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde (PubChem CID 87202457) has the molecular formula C30H20F3N3O3 and a molecular weight of 527.50 g/mol. Its IUPAC name is 2-[4-[3-[(3-nitrophenyl)methylamino]phenyl]-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde.
| Compound Name | 2-[4-[3-[(3-nitrophenyl)methylamino]phenyl]-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 87202457 |
| Molecular Formula | C30H20F3N3O3 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 2-[4-[3-[(3-nitrophenyl)methylamino]phenyl]-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde |
| SMILES | O=Cc1ccccc1-c1cnc2c(C(F)(F)F)cccc2c1-c1cccc(NCc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C30H20F3N3O3/c31-30(32,33)27-13-5-12-25-28(26(17-35-29(25)27)24-11-2-1-7-21(24)18-37)20-8-4-9-22(15-20)34-16-19-6-3-10-23(14-19)36(38)39/h1-15,17-18,34H,16H2 |
| InChIKey | SFWBTGJCTCXCLM-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|