C31H22F3N3 — CID 66914317
N-(1H-indol-5-ylmethyl)-3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]aniline (PubChem CID 66914317) has the molecular formula C31H22F3N3 and a molecular weight of 493.53 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]aniline.
| Compound Name | N-(1H-indol-5-ylmethyl)-3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]aniline |
|---|---|
| PubChem CID | 66914317 |
| Molecular Formula | C31H22F3N3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]aniline |
| SMILES | FC(F)(F)c1cccc2c(-c3cccc(NCc4ccc5[nH]ccc5c4)c3)c(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C31H22F3N3/c32-31(33,34)27-11-5-10-25-29(26(19-37-30(25)27)21-6-2-1-3-7-21)23-8-4-9-24(17-23)36-18-20-12-13-28-22(16-20)14-15-35-28/h1-17,19,35-36H,18H2 |
| InChIKey | HSGBCWPHZVVGLN-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |