C24H19F3N2O — CID 174518736
[4-[[3-[8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]methanol (PubChem CID 174518736) has the molecular formula C24H19F3N2O and a molecular weight of 408.42 g/mol. Its IUPAC name is [4-[[3-[8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]methanol.
| Compound Name | [4-[[3-[8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 174518736 |
| Molecular Formula | C24H19F3N2O |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [4-[[3-[8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CNc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C24H19F3N2O/c25-24(26,27)22-6-2-5-21-20(11-12-28-23(21)22)18-3-1-4-19(13-18)29-14-16-7-9-17(15-30)10-8-16/h1-13,29-30H,14-15H2 |
| InChIKey | CCSRGAMBROUBKP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |