C25H21F3N2O — CID 174518702
N-[(2-methoxyphenyl)methyl]-1-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methanamine (PubChem CID 174518702) has the molecular formula C25H21F3N2O and a molecular weight of 422.45 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-1-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methanamine.
| Compound Name | N-[(2-methoxyphenyl)methyl]-1-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 174518702 |
| Molecular Formula | C25H21F3N2O |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-1-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methanamine |
| SMILES | COc1ccccc1CNCc1cccc(-c2ccnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C25H21F3N2O/c1-31-23-11-3-2-7-19(23)16-29-15-17-6-4-8-18(14-17)20-12-13-30-24-21(20)9-5-10-22(24)25(26,27)28/h2-14,29H,15-16H2,1H3 |
| InChIKey | UZLJXLRYERXCOC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |