C16H17BrF3NO — CID 75531292
N-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]methanamine;hydrobromide (PubChem CID 75531292) has the molecular formula C16H17BrF3NO and a molecular weight of 376.22 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]methanamine;hydrobromide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]methanamine;hydrobromide |
|---|---|
| PubChem CID | 75531292 |
| Molecular Formula | C16H17BrF3NO |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]methanamine;hydrobromide |
| SMILES | Br.COc1ccccc1CNCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO.BrH/c1-21-15-9-5-3-7-13(15)11-20-10-12-6-2-4-8-14(12)16(17,18)19;/h2-9,20H,10-11H2,1H3;1H |
| InChIKey | NWBSZWDNFQLLDP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |