C16H17ClF3N — CID 17332531
1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine;hydrochloride (PubChem CID 17332531) has the molecular formula C16H17ClF3N and a molecular weight of 315.77 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine;hydrochloride.
| Compound Name | 1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 17332531 |
| Molecular Formula | C16H17ClF3N |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(4-methylphenyl)-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine;hydrochloride |
| SMILES | Cc1ccc(CNCc2ccccc2C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C16H16F3N.ClH/c1-12-6-8-13(9-7-12)10-20-11-14-4-2-3-5-15(14)16(17,18)19;/h2-9,20H,10-11H2,1H3;1H |
| InChIKey | AQUOUDXQPLZFKG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |