C24H20F3N3 — CID 174518717
2-(aminomethyl)-N-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]aniline (PubChem CID 174518717) has the molecular formula C24H20F3N3 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]aniline.
| Compound Name | 2-(aminomethyl)-N-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 174518717 |
| Molecular Formula | C24H20F3N3 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-(aminomethyl)-N-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methyl]aniline |
| SMILES | NCc1ccccc1NCc1cccc(-c2ccnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C24H20F3N3/c25-24(26,27)21-9-4-8-20-19(11-12-29-23(20)21)17-7-3-5-16(13-17)15-30-22-10-2-1-6-18(22)14-28/h1-13,30H,14-15,28H2 |
| InChIKey | YHKQBPHHDIGWTP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |