C28H19F3N2O2 — CID 25224643
6-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methylamino]naphthalene-2-carboxylic acid (PubChem CID 25224643) has the molecular formula C28H19F3N2O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is 6-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methylamino]naphthalene-2-carboxylic acid.
| Compound Name | 6-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methylamino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 25224643 |
| Molecular Formula | C28H19F3N2O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 6-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]methylamino]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(NCc3cccc(-c4ccnc5c(C(F)(F)F)cccc45)c3)ccc2c1 |
| InChI | InChI=1S/C28H19F3N2O2/c29-28(30,31)25-6-2-5-24-23(11-12-32-26(24)25)20-4-1-3-17(13-20)16-33-22-10-9-18-14-21(27(34)35)8-7-19(18)15-22/h1-15,33H,16H2,(H,34,35) |
| InChIKey | NDIOIQDCXUDCRD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |