C26H23F3N2 — CID 174504635
N-[(4-propan-2-ylphenyl)methyl]-3-[8-(trifluoromethyl)quinolin-4-yl]aniline (PubChem CID 174504635) has the molecular formula C26H23F3N2 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[(4-propan-2-ylphenyl)methyl]-3-[8-(trifluoromethyl)quinolin-4-yl]aniline.
| Compound Name | N-[(4-propan-2-ylphenyl)methyl]-3-[8-(trifluoromethyl)quinolin-4-yl]aniline |
|---|---|
| PubChem CID | 174504635 |
| Molecular Formula | C26H23F3N2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(4-propan-2-ylphenyl)methyl]-3-[8-(trifluoromethyl)quinolin-4-yl]aniline |
| SMILES | CC(C)c1ccc(CNc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C26H23F3N2/c1-17(2)19-11-9-18(10-12-19)16-31-21-6-3-5-20(15-21)22-13-14-30-25-23(22)7-4-8-24(25)26(27,28)29/h3-15,17,31H,16H2,1-2H3 |
| InChIKey | VRXFCFHGSBIRJR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |