C25H18F3NO3 — CID 91451089
[4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate (PubChem CID 91451089) has the molecular formula C25H18F3NO3 and a molecular weight of 437.42 g/mol. Its IUPAC name is [4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate.
| Compound Name | [4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 91451089 |
| Molecular Formula | C25H18F3NO3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C25H18F3NO3/c1-16(30)32-19-10-8-17(9-11-19)15-31-20-5-2-4-18(14-20)21-12-13-29-24-22(21)6-3-7-23(24)25(26,27)28/h2-14H,15H2,1H3 |
| InChIKey | SACDRGZNKKKVFZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|