C33H26F3NO4 — CID 91038678
[4-[[3-[3-phenoxy-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] butanoate (PubChem CID 91038678) has the molecular formula C33H26F3NO4 and a molecular weight of 557.57 g/mol. Its IUPAC name is [4-[[3-[3-phenoxy-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] butanoate.
| Compound Name | [4-[[3-[3-phenoxy-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] butanoate |
|---|---|
| PubChem CID | 91038678 |
| Molecular Formula | C33H26F3NO4 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | [4-[[3-[3-phenoxy-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(COc2cccc(-c3c(Oc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C33H26F3NO4/c1-2-8-30(38)41-25-17-15-22(16-18-25)21-39-26-12-6-9-23(19-26)31-27-13-7-14-28(33(34,35)36)32(27)37-20-29(31)40-24-10-4-3-5-11-24/h3-7,9-20H,2,8,21H2,1H3 |
| InChIKey | QDIGKVDGEYCUTM-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|