C33H24F3NO3 — CID 68812320
(E)-2-methyl-3-[4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]prop-2-enoic acid (PubChem CID 68812320) has the molecular formula C33H24F3NO3 and a molecular weight of 539.55 g/mol. Its IUPAC name is (E)-2-methyl-3-[4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-[4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68812320 |
| Molecular Formula | C33H24F3NO3 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (E)-2-methyl-3-[4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]prop-2-enoic acid |
| SMILES | C/C(=C\c1ccc(COc2cccc(-c3c(-c4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1)C(=O)O |
| InChI | InChI=1S/C33H24F3NO3/c1-21(32(38)39)17-22-13-15-23(16-14-22)20-40-26-10-5-9-25(18-26)30-27-11-6-12-29(33(34,35)36)31(27)37-19-28(30)24-7-3-2-4-8-24/h2-19H,20H2,1H3,(H,38,39)/b21-17+ |
| InChIKey | NFFYXIZXZKQFIP-HEHNFIMWSA-N |
| XLogP | 8.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|