C24H16F3NO4S — CID 56597856
[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate (PubChem CID 56597856) has the molecular formula C24H16F3NO4S and a molecular weight of 471.46 g/mol. Its IUPAC name is [3-[8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate.
| Compound Name | [3-[8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 56597856 |
| Molecular Formula | C24H16F3NO4S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | [3-[8-(trifluoromethyl)quinolin-4-yl]phenyl] 3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Oc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C24H16F3NO4S/c1-33(30,31)18-8-3-6-16(14-18)23(29)32-17-7-2-5-15(13-17)19-11-12-28-22-20(19)9-4-10-21(22)24(25,26)27/h2-14H,1H3 |
| InChIKey | DMBMZYBRXVXPBK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|