C28H27F3N2O3S — CID 143659754
methane;4-[3-(3-piperidin-4-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 143659754) has the molecular formula C28H27F3N2O3S and a molecular weight of 528.60 g/mol. Its IUPAC name is methane;4-[3-(3-piperidin-4-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | methane;4-[3-(3-piperidin-4-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 143659754 |
| Molecular Formula | C28H27F3N2O3S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | methane;4-[3-(3-piperidin-4-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | C.O=S(=O)(c1cccc(Oc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)c1)C1CCNCC1 |
| InChI | InChI=1S/C27H23F3N2O3S.CH4/c28-27(29,30)25-9-3-8-24-23(12-15-32-26(24)25)18-4-1-5-19(16-18)35-20-6-2-7-22(17-20)36(33,34)21-10-13-31-14-11-21;/h1-9,12,15-17,21,31H,10-11,13-14H2;1H4 |
| InChIKey | BOBZWZJBYQYZNX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |