C25H18F3NO2S — CID 154136730
4-[3-(3-prop-1-enylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 154136730) has the molecular formula C25H18F3NO2S and a molecular weight of 453.49 g/mol. Its IUPAC name is 4-[3-(3-prop-1-enylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(3-prop-1-enylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 154136730 |
| Molecular Formula | C25H18F3NO2S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 4-[3-(3-prop-1-enylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | CC=CS(=O)(=O)c1cccc(-c2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C25H18F3NO2S/c1-2-14-32(30,31)20-9-4-7-18(16-20)17-6-3-8-19(15-17)21-12-13-29-24-22(21)10-5-11-23(24)25(26,27)28/h2-16H,1H3 |
| InChIKey | MTEPPZCJICSDAP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |