C26H23F3N2O2S — CID 91282827
3-[3-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]phenyl]sulfonylbutan-1-amine (PubChem CID 91282827) has the molecular formula C26H23F3N2O2S and a molecular weight of 484.54 g/mol. Its IUPAC name is 3-[3-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]phenyl]sulfonylbutan-1-amine.
| Compound Name | 3-[3-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]phenyl]sulfonylbutan-1-amine |
|---|---|
| PubChem CID | 91282827 |
| Molecular Formula | C26H23F3N2O2S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[3-[3-[8-(trifluoromethyl)quinolin-4-yl]phenyl]phenyl]sulfonylbutan-1-amine |
| SMILES | CC(CCN)S(=O)(=O)c1cccc(-c2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C26H23F3N2O2S/c1-17(11-13-30)34(32,33)21-8-3-6-19(16-21)18-5-2-7-20(15-18)22-12-14-31-25-23(22)9-4-10-24(25)26(27,28)29/h2-10,12,14-17H,11,13,30H2,1H3 |
| InChIKey | DSWOUNWVMBSPBM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |