C23H15F4NO3S — CID 68876323
4-[2-fluoro-5-(4-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 68876323) has the molecular formula C23H15F4NO3S and a molecular weight of 461.44 g/mol. Its IUPAC name is 4-[2-fluoro-5-(4-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[2-fluoro-5-(4-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 68876323 |
| Molecular Formula | C23H15F4NO3S |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 4-[2-fluoro-5-(4-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(F)c(-c3ccnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C23H15F4NO3S/c1-32(29,30)16-8-5-14(6-9-16)31-15-7-10-21(24)19(13-15)17-11-12-28-22-18(17)3-2-4-20(22)23(25,26)27/h2-13H,1H3 |
| InChIKey | WCKJDTQCBPNWFV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |