C26H22F3NO3S — CID 68877282
4-[2-methyl-5-(4-propan-2-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 68877282) has the molecular formula C26H22F3NO3S and a molecular weight of 485.53 g/mol. Its IUPAC name is 4-[2-methyl-5-(4-propan-2-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[2-methyl-5-(4-propan-2-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 68877282 |
| Molecular Formula | C26H22F3NO3S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-[2-methyl-5-(4-propan-2-ylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | Cc1ccc(Oc2ccc(S(=O)(=O)C(C)C)cc2)cc1-c1ccnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C26H22F3NO3S/c1-16(2)34(31,32)20-11-9-18(10-12-20)33-19-8-7-17(3)23(15-19)21-13-14-30-25-22(21)5-4-6-24(25)26(27,28)29/h4-16H,1-3H3 |
| InChIKey | SNQZQLUJFZOKTF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |