C23H14F5NO3S — CID 68876326
4-[2-fluoro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 68876326) has the molecular formula C23H14F5NO3S and a molecular weight of 479.43 g/mol. Its IUPAC name is 4-[2-fluoro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[2-fluoro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 68876326 |
| Molecular Formula | C23H14F5NO3S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4-[2-fluoro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | CS(=O)(=O)c1cc(F)cc(Oc2ccc(F)c(-c3ccnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C23H14F5NO3S/c1-33(30,31)16-10-13(24)9-15(11-16)32-14-5-6-21(25)19(12-14)17-7-8-29-22-18(17)3-2-4-20(22)23(26,27)28/h2-12H,1H3 |
| InChIKey | KJDBYCCFGBODBD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |