C21H13Cl2FN2O3S — CID 25261487
8-chloro-4-[2-chloro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]quinazoline (PubChem CID 25261487) has the molecular formula C21H13Cl2FN2O3S and a molecular weight of 463.32 g/mol. Its IUPAC name is 8-chloro-4-[2-chloro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]quinazoline.
| Compound Name | 8-chloro-4-[2-chloro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]quinazoline |
|---|---|
| PubChem CID | 25261487 |
| Molecular Formula | C21H13Cl2FN2O3S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 8-chloro-4-[2-chloro-5-(3-fluoro-5-methylsulfonylphenoxy)phenyl]quinazoline |
| SMILES | CS(=O)(=O)c1cc(F)cc(Oc2ccc(Cl)c(-c3ncnc4c(Cl)cccc34)c2)c1 |
| InChI | InChI=1S/C21H13Cl2FN2O3S/c1-30(27,28)15-8-12(24)7-14(9-15)29-13-5-6-18(22)17(10-13)20-16-3-2-4-19(23)21(16)26-11-25-20/h2-11H,1H3 |
| InChIKey | FSUHKKALGYKGBZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |