C25H23ClFN3O3S — CID 91294133
4-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylpentan-1-amine (PubChem CID 91294133) has the molecular formula C25H23ClFN3O3S and a molecular weight of 500.00 g/mol. Its IUPAC name is 4-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylpentan-1-amine.
| Compound Name | 4-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylpentan-1-amine |
|---|---|
| PubChem CID | 91294133 |
| Molecular Formula | C25H23ClFN3O3S |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 4-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylpentan-1-amine |
| SMILES | CC(CCCN)S(=O)(=O)c1cccc(Oc2ccc(F)c(-c3ncnc4c(Cl)cccc34)c2)c1 |
| InChI | InChI=1S/C25H23ClFN3O3S/c1-16(5-4-12-28)34(31,32)19-7-2-6-17(13-19)33-18-10-11-23(27)21(14-18)24-20-8-3-9-22(26)25(20)30-15-29-24/h2-3,6-11,13-16H,4-5,12,28H2,1H3 |
| InChIKey | WPHNYPMTSPFZGW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |