C22H15ClF2N2O3S — CID 25260843
8-chloro-4-[5-(3-ethylsulfonyl-5-fluorophenoxy)-2-fluorophenyl]quinazoline (PubChem CID 25260843) has the molecular formula C22H15ClF2N2O3S and a molecular weight of 460.89 g/mol. Its IUPAC name is 8-chloro-4-[5-(3-ethylsulfonyl-5-fluorophenoxy)-2-fluorophenyl]quinazoline.
| Compound Name | 8-chloro-4-[5-(3-ethylsulfonyl-5-fluorophenoxy)-2-fluorophenyl]quinazoline |
|---|---|
| PubChem CID | 25260843 |
| Molecular Formula | C22H15ClF2N2O3S |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 8-chloro-4-[5-(3-ethylsulfonyl-5-fluorophenoxy)-2-fluorophenyl]quinazoline |
| SMILES | CCS(=O)(=O)c1cc(F)cc(Oc2ccc(F)c(-c3ncnc4c(Cl)cccc34)c2)c1 |
| InChI | InChI=1S/C22H15ClF2N2O3S/c1-2-31(28,29)16-9-13(24)8-15(10-16)30-14-6-7-20(25)18(11-14)21-17-4-3-5-19(23)22(17)27-12-26-21/h3-12H,2H2,1H3 |
| InChIKey | SEUMVZJSMMWOJK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |