C22H13ClFN3O3S — CID 59411241
2-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylacetonitrile (PubChem CID 59411241) has the molecular formula C22H13ClFN3O3S and a molecular weight of 453.88 g/mol. Its IUPAC name is 2-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylacetonitrile.
| Compound Name | 2-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylacetonitrile |
|---|---|
| PubChem CID | 59411241 |
| Molecular Formula | C22H13ClFN3O3S |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-[3-[3-(8-chloroquinazolin-4-yl)-4-fluorophenoxy]phenyl]sulfonylacetonitrile |
| SMILES | N#CCS(=O)(=O)c1cccc(Oc2ccc(F)c(-c3ncnc4c(Cl)cccc34)c2)c1 |
| InChI | InChI=1S/C22H13ClFN3O3S/c23-19-6-2-5-17-21(26-13-27-22(17)19)18-12-15(7-8-20(18)24)30-14-3-1-4-16(11-14)31(28,29)10-9-25/h1-8,11-13H,10H2 |
| InChIKey | IOHRGFRUXJQJEJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |