C8H5Cl2NO2S — CID 610700
2-(2,6-dichlorophenyl)sulfonylacetonitrile (PubChem CID 610700) has the molecular formula C8H5Cl2NO2S and a molecular weight of 250.11 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)sulfonylacetonitrile.
| Compound Name | 2-(2,6-dichlorophenyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 610700 |
| Molecular Formula | C8H5Cl2NO2S |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 248.94 |
| IUPAC Name | 2-(2,6-dichlorophenyl)sulfonylacetonitrile |
| SMILES | N#CCS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H5Cl2NO2S/c9-6-2-1-3-7(10)8(6)14(12,13)5-4-11/h1-3H,5H2 |
| InChIKey | ADKHNJYUXPNKBN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |