C13H16Cl2N3O2S+ — CID 9443852
3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile (PubChem CID 9443852) has the molecular formula C13H16Cl2N3O2S+ and a molecular weight of 349.26 g/mol. Its IUPAC name is 3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile.
| Compound Name | 3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 9443852 |
| Molecular Formula | C13H16Cl2N3O2S+ |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile |
| SMILES | N#CCC[NH+]1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C13H15Cl2N3O2S/c14-11-3-1-4-12(15)13(11)21(19,20)18-9-7-17(8-10-18)6-2-5-16/h1,3-4H,2,6-10H2/p+1 |
| InChIKey | ZRXRYQRZFPATGI-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |