C14H20Cl2N3O3S+ — CID 8754410
N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]acetamide (PubChem CID 8754410) has the molecular formula C14H20Cl2N3O3S+ and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 8754410 |
| Molecular Formula | C14H20Cl2N3O3S+ |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCC[NH+]1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O3S/c1-11(20)17-5-6-18-7-9-19(10-8-18)23(21,22)13-4-2-3-12(15)14(13)16/h2-4H,5-10H2,1H3,(H,17,20)/p+1 |
| InChIKey | GQBURMLQZHXJBD-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |