C14H19Cl2N3O3S — CID 8754411
N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]ethyl]acetamide (PubChem CID 8754411) has the molecular formula C14H19Cl2N3O3S and a molecular weight of 380.30 g/mol. Its IUPAC name is N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 8754411 |
| Molecular Formula | C14H19Cl2N3O3S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-[2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O3S/c1-11(20)17-5-6-18-7-9-19(10-8-18)23(21,22)13-4-2-3-12(15)14(13)16/h2-4H,5-10H2,1H3,(H,17,20) |
| InChIKey | GQBURMLQZHXJBD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |