C17H25Cl2N3O3S — CID 8758220
2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-pentan-3-ylacetamide (PubChem CID 8758220) has the molecular formula C17H25Cl2N3O3S and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-pentan-3-ylacetamide.
| Compound Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 8758220 |
| Molecular Formula | C17H25Cl2N3O3S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CN1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C17H25Cl2N3O3S/c1-3-13(4-2)20-16(23)12-21-8-10-22(11-9-21)26(24,25)15-7-5-6-14(18)17(15)19/h5-7,13H,3-4,8-12H2,1-2H3,(H,20,23) |
| InChIKey | KTAAGLAINYEMLG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |