C18H26F3N3O3S — CID 8749052
N-[(2S)-pentan-2-yl]-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 8749052) has the molecular formula C18H26F3N3O3S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[(2S)-pentan-2-yl]-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-[(2S)-pentan-2-yl]-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8749052 |
| Molecular Formula | C18H26F3N3O3S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[(2S)-pentan-2-yl]-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)CN1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N3O3S/c1-3-6-14(2)22-17(25)13-23-9-11-24(12-10-23)28(26,27)16-8-5-4-7-15(16)18(19,20)21/h4-5,7-8,14H,3,6,9-13H2,1-2H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | MMQZCHHYEHTBBN-AWEZNQCLSA-N |
| XLogP | 2.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |