C13H17F3N2O2 — CID 47020753
2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-pentan-2-ylacetamide (PubChem CID 47020753) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-pentan-2-ylacetamide.
| Compound Name | 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 47020753 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)Cn1cccc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C13H17F3N2O2/c1-3-5-9(2)17-11(19)8-18-7-4-6-10(12(18)20)13(14,15)16/h4,6-7,9H,3,5,8H2,1-2H3,(H,17,19) |
| InChIKey | JXLKGBIKPZHDIZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |