C21H25F3N2O3 — CID 86877255
N-[1-[4-(3-methylbutoxy)phenyl]ethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 86877255) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[1-[4-(3-methylbutoxy)phenyl]ethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[1-[4-(3-methylbutoxy)phenyl]ethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 86877255 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[1-[4-(3-methylbutoxy)phenyl]ethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CC(C)CCOc1ccc(C(C)NC(=O)Cn2cccc(C(F)(F)F)c2=O)cc1 |
| InChI | InChI=1S/C21H25F3N2O3/c1-14(2)10-12-29-17-8-6-16(7-9-17)15(3)25-19(27)13-26-11-4-5-18(20(26)28)21(22,23)24/h4-9,11,14-15H,10,12-13H2,1-3H3,(H,25,27) |
| InChIKey | WADYUGAFRGDDTF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |