C18H17F3N2O3 — CID 39041536
N-[(1S)-1-[4-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]ethyl]acetamide (PubChem CID 39041536) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is N-[(1S)-1-[4-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[4-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 39041536 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[(1S)-1-[4-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]phenyl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1ccc(C(=O)Cn2cccc(C(F)(F)F)c2=O)cc1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-11(22-12(2)24)13-5-7-14(8-6-13)16(25)10-23-9-3-4-15(17(23)26)18(19,20)21/h3-9,11H,10H2,1-2H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | UTJNEVWKHBRSDY-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |