C12H15F3N2O3 — CID 111429139
N-(3-hydroxybutyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 111429139) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(3-hydroxybutyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 111429139 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(3-hydroxybutyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CC(O)CCNC(=O)Cn1cccc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C12H15F3N2O3/c1-8(18)4-5-16-10(19)7-17-6-2-3-9(11(17)20)12(13,14)15/h2-3,6,8,18H,4-5,7H2,1H3,(H,16,19) |
| InChIKey | QPULFEWKCGTDAP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |