C14H13F3N2O3S — CID 111441452
N-(2-hydroxy-2-thiophen-3-ylethyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 111441452) has the molecular formula C14H13F3N2O3S and a molecular weight of 346.33 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 111441452 |
| Molecular Formula | C14H13F3N2O3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C14H13F3N2O3S/c15-14(16,17)10-2-1-4-19(13(10)22)7-12(21)18-6-11(20)9-3-5-23-8-9/h1-5,8,11,20H,6-7H2,(H,18,21) |
| InChIKey | FEKJQWSLXVTAPE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |