C16H12F6N2O2 — CID 32923314
2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 32923314) has the molecular formula C16H12F6N2O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 32923314 |
| Molecular Formula | C16H12F6N2O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F6N2O2/c17-15(18,19)11-5-3-10(4-6-11)8-23-13(25)9-24-7-1-2-12(14(24)26)16(20,21)22/h1-7H,8-9H2,(H,23,25) |
| InChIKey | VOPJBYPYNVEPSK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |