C14H13F3N2O4 — CID 110889033
N-[2-(furan-2-yl)-2-hydroxyethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 110889033) has the molecular formula C14H13F3N2O4 and a molecular weight of 330.26 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxyethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 110889033 |
| Molecular Formula | C14H13F3N2O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C14H13F3N2O4/c15-14(16,17)9-3-1-5-19(13(9)22)8-12(21)18-7-10(20)11-4-2-6-23-11/h1-6,10,20H,7-8H2,(H,18,21) |
| InChIKey | FVLBOSVOIUWBKK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |