C23H20F3N3O3 — CID 55693879
N-[3-[1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]phenyl]benzamide (PubChem CID 55693879) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is N-[3-[1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]phenyl]benzamide.
| Compound Name | N-[3-[1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55693879 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[3-[1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]ethyl]phenyl]benzamide |
| SMILES | CC(NC(=O)Cn1cccc(C(F)(F)F)c1=O)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20F3N3O3/c1-15(27-20(30)14-29-12-6-11-19(22(29)32)23(24,25)26)17-9-5-10-18(13-17)28-21(31)16-7-3-2-4-8-16/h2-13,15H,14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | BBPFDHQPOFRUKA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |