C16H23F2N3O3S — CID 46572180
N-butan-2-yl-2-[4-(3,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 46572180) has the molecular formula C16H23F2N3O3S and a molecular weight of 375.44 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-(3,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-(3,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46572180 |
| Molecular Formula | C16H23F2N3O3S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-butan-2-yl-2-[4-(3,5-difluorophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(S(=O)(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C16H23F2N3O3S/c1-3-12(2)19-16(22)11-20-4-6-21(7-5-20)25(23,24)15-9-13(17)8-14(18)10-15/h8-10,12H,3-7,11H2,1-2H3,(H,19,22) |
| InChIKey | BKDZUOZNXJYFBT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |