C15H18F3N3O2S — CID 8689830
(2R)-2-methyl-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanenitrile (PubChem CID 8689830) has the molecular formula C15H18F3N3O2S and a molecular weight of 361.39 g/mol. Its IUPAC name is (2R)-2-methyl-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanenitrile.
| Compound Name | (2R)-2-methyl-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 8689830 |
| Molecular Formula | C15H18F3N3O2S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2R)-2-methyl-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanenitrile |
| SMILES | C[C@@H](C#N)CN1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18F3N3O2S/c1-12(10-19)11-20-6-8-21(9-7-20)24(22,23)14-5-3-2-4-13(14)15(16,17)18/h2-5,12H,6-9,11H2,1H3/t12-/m0/s1 |
| InChIKey | HPRBRTIHVYDSDJ-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |