C16H17F3N2O2S2 — CID 30990917
1-(thiophen-2-ylmethyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 30990917) has the molecular formula C16H17F3N2O2S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-(thiophen-2-ylmethyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 30990917 |
| Molecular Formula | C16H17F3N2O2S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H17F3N2O2S2/c17-16(18,19)14-5-1-2-6-15(14)25(22,23)21-9-7-20(8-10-21)12-13-4-3-11-24-13/h1-6,11H,7-10,12H2 |
| InChIKey | GBLFJZJRFDUULN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |