C15H15BrCl2N2O2S2 — CID 30172890
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine (PubChem CID 30172890) has the molecular formula C15H15BrCl2N2O2S2 and a molecular weight of 470.24 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 30172890 |
| Molecular Formula | C15H15BrCl2N2O2S2 |
| Molecular Weight | 470.24 g/mol |
| Exact Mass | 467.91 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H15BrCl2N2O2S2/c16-11-8-13(17)15(14(18)9-11)24(21,22)20-5-3-19(4-6-20)10-12-2-1-7-23-12/h1-2,7-9H,3-6,10H2 |
| InChIKey | NTXKBNHMEDARQR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |