C17H15BrCl2N2O3S2 — CID 2446199
(E)-1-[4-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 2446199) has the molecular formula C17H15BrCl2N2O3S2 and a molecular weight of 510.26 g/mol. Its IUPAC name is (E)-1-[4-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 2446199 |
| Molecular Formula | C17H15BrCl2N2O3S2 |
| Molecular Weight | 510.26 g/mol |
| Exact Mass | 507.91 |
| IUPAC Name | (E)-1-[4-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)N1CCN(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C17H15BrCl2N2O3S2/c18-12-10-14(19)17(15(20)11-12)27(24,25)22-7-5-21(6-8-22)16(23)4-3-13-2-1-9-26-13/h1-4,9-11H,5-8H2/b4-3+ |
| InChIKey | XGUMAQXYROHCKX-ONEGZZNKSA-N |
| XLogP | 4.36 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|