C20H21N3O4S3 — CID 53112833
3-ethyl-6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one (PubChem CID 53112833) has the molecular formula C20H21N3O4S3 and a molecular weight of 463.61 g/mol. Its IUPAC name is 3-ethyl-6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one.
| Compound Name | 3-ethyl-6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 53112833 |
| Molecular Formula | C20H21N3O4S3 |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 3-ethyl-6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one |
| SMILES | CCn1c(=O)sc2cc(S(=O)(=O)N3CCN(C(=O)/C=C/c4cccs4)CC3)ccc21 |
| InChI | InChI=1S/C20H21N3O4S3/c1-2-23-17-7-6-16(14-18(17)29-20(23)25)30(26,27)22-11-9-21(10-12-22)19(24)8-5-15-4-3-13-28-15/h3-8,13-14H,2,9-12H2,1H3/b8-5+ |
| InChIKey | ZUSPEPVDTFFCMR-VMPITWQZSA-N |
| XLogP | 2.69 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|