C21H23N3O5S2 — CID 71843379
3-propan-2-yl-6-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one (PubChem CID 71843379) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 3-propan-2-yl-6-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one.
| Compound Name | 3-propan-2-yl-6-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 71843379 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-propan-2-yl-6-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one |
| SMILES | CC(C)n1c(=O)oc2cc(S(=O)(=O)N3CCN(C(=O)C=Cc4cccs4)CC3)ccc21 |
| InChI | InChI=1S/C21H23N3O5S2/c1-15(2)24-18-7-6-17(14-19(18)29-21(24)26)31(27,28)23-11-9-22(10-12-23)20(25)8-5-16-4-3-13-30-16/h3-8,13-15H,9-12H2,1-2H3 |
| InChIKey | OLFDTTPREQHPAG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|