C18H17N3O4S3 — CID 53112690
6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-3H-1,3-benzothiazol-2-one (PubChem CID 53112690) has the molecular formula C18H17N3O4S3 and a molecular weight of 435.55 g/mol. Its IUPAC name is 6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 53112690 |
| Molecular Formula | C18H17N3O4S3 |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 6-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]piperazin-1-yl]sulfonyl-3H-1,3-benzothiazol-2-one |
| SMILES | O=C(/C=C/c1cccs1)N1CCN(S(=O)(=O)c2ccc3[nH]c(=O)sc3c2)CC1 |
| InChI | InChI=1S/C18H17N3O4S3/c22-17(6-3-13-2-1-11-26-13)20-7-9-21(10-8-20)28(24,25)14-4-5-15-16(12-14)27-18(23)19-15/h1-6,11-12H,7-10H2,(H,19,23)/b6-3+ |
| InChIKey | JIQJLXLYWOHVQT-ZZXKWVIFSA-N |
| XLogP | 2.20 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|